C13H14N4O2S — CID 69387946
2-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxylic acid (PubChem CID 69387946) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxylic acid.
| Compound Name | 2-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69387946 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCNCC1c1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C13H14N4O2S/c18-13(19)17-7-6-14-8-10(17)12-15-11(16-20-12)9-4-2-1-3-5-9/h1-5,10,14H,6-8H2,(H,18,19) |
| InChIKey | MYMJQVAXCCFECY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |