C8H12Cl5N3 — CID 69388337
4-methyl-3-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole (PubChem CID 69388337) has the molecular formula C8H12Cl5N3 and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-methyl-3-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole.
| Compound Name | 4-methyl-3-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69388337 |
| Molecular Formula | C8H12Cl5N3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 4-methyl-3-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole |
| SMILES | CCCN1N=CN(C)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl5N3/c1-3-4-16-6(15(2)5-14-16)7(9,10)8(11,12)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | GOOXJZNCSUNZCF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|