C30H54N8O2 — CID 69388519
3-nitro-N-pentylpyridin-2-amine;2-N-pentylpyridine-2,5-diamine;bis(piperidine) (PubChem CID 69388519) has the molecular formula C30H54N8O2 and a molecular weight of 558.82 g/mol. Its IUPAC name is 3-nitro-N-pentylpyridin-2-amine;2-N-pentylpyridine-2,5-diamine;bis(piperidine).
| Compound Name | 3-nitro-N-pentylpyridin-2-amine;2-N-pentylpyridine-2,5-diamine;bis(piperidine) |
|---|---|
| PubChem CID | 69388519 |
| Molecular Formula | C30H54N8O2 |
| Molecular Weight | 558.82 g/mol |
| Exact Mass | 558.44 |
| IUPAC Name | 3-nitro-N-pentylpyridin-2-amine;2-N-pentylpyridine-2,5-diamine;bis(piperidine) |
| SMILES | C1CCNCC1.C1CCNCC1.CCCCCNc1ccc(N)cn1.CCCCCNc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O2.C10H17N3.2C5H11N/c1-2-3-4-7-11-10-9(13(14)15)6-5-8-12-10;1-2-3-4-7-12-10-6-5-9(11)8-13-10;2*1-2-4-6-5-3-1/h5-6,8H,2-4,7H2,1H3,(H,11,12);5-6,8H,2-4,7,11H2,1H3,(H,12,13);2*6H,1-5H2 |
| InChIKey | ORRIGDXCDNODKD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|