C24H42O4 — CID 69389198
(4-tert-butylcyclohexyl) acetate;3,7-dimethylocta-1,6-dien-3-yl acetate (PubChem CID 69389198) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) acetate;3,7-dimethylocta-1,6-dien-3-yl acetate.
| Compound Name | (4-tert-butylcyclohexyl) acetate;3,7-dimethylocta-1,6-dien-3-yl acetate |
|---|---|
| PubChem CID | 69389198 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (4-tert-butylcyclohexyl) acetate;3,7-dimethylocta-1,6-dien-3-yl acetate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(C)=O.CC(=O)OC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22O2.C12H20O2/c1-9(13)14-11-7-5-10(6-8-11)12(2,3)4;1-6-12(5,14-11(4)13)9-7-8-10(2)3/h10-11H,5-8H2,1-4H3;6,8H,1,7,9H2,2-5H3 |
| InChIKey | DIDIIFNKWMVZKB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|