About 1,3,5-triethylpyridin-1-ium
1,3,5-triethylpyridin-1-ium (PubChem CID 69390733) has the molecular formula C11H18N+
and a molecular weight of 164.27 g/mol. Its IUPAC name is 1,3,5-triethylpyridin-1-ium.
Molecular Properties
| Compound Name | 1,3,5-triethylpyridin-1-ium |
| PubChem CID | 69390733 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | 1,3,5-triethylpyridin-1-ium |
| SMILES | CCc1cc(CC)c[n+](CC)c1 |
| InChI | InChI=1S/C11H18N/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3/q+1 |
| InChIKey | GNMBRXVUJPANOG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-triethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triethylpyridin-1-ium?
The IUPAC name of 1,3,5-triethylpyridin-1-ium (CID 69390733) is 1,3,5-triethylpyridin-1-ium.
What is the SMILES notation for 1,3,5-triethylpyridin-1-ium?
The canonical SMILES for 1,3,5-triethylpyridin-1-ium is CCc1cc(CC)c[n+](CC)c1.
What is the InChIKey of 1,3,5-triethylpyridin-1-ium?
The InChIKey is GNMBRXVUJPANOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3/q+1.
What are the key properties of 1,3,5-triethylpyridin-1-ium?
1,3,5-triethylpyridin-1-ium has a molecular weight of 164.27 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triethylpyridin-1-ium is sourced from PubChem (CID 69390733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).