About azane;methane;2-oxabicyclo[3.1.0]hexane
azane;methane;2-oxabicyclo[3.1.0]hexane (PubChem CID 69393686) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is azane;methane;2-oxabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | azane;methane;2-oxabicyclo[3.1.0]hexane |
| PubChem CID | 69393686 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | azane;methane;2-oxabicyclo[3.1.0]hexane |
| SMILES | C.C1CC2CC2O1.N |
| InChI | InChI=1S/C5H8O.CH4.H3N/c1-2-6-5-3-4(1)5;;/h4-5H,1-3H2;1H4;1H3 |
| InChIKey | ZJIGVIQZYBKTAU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 44.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;methane;2-oxabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methane;2-oxabicyclo[3.1.0]hexane?
The IUPAC name of azane;methane;2-oxabicyclo[3.1.0]hexane (CID 69393686) is azane;methane;2-oxabicyclo[3.1.0]hexane.
What is the SMILES notation for azane;methane;2-oxabicyclo[3.1.0]hexane?
The canonical SMILES for azane;methane;2-oxabicyclo[3.1.0]hexane is C.C1CC2CC2O1.N.
What is the InChIKey of azane;methane;2-oxabicyclo[3.1.0]hexane?
The InChIKey is ZJIGVIQZYBKTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O.CH4.H3N/c1-2-6-5-3-4(1)5;;/h4-5H,1-3H2;1H4;1H3.
What are the key properties of azane;methane;2-oxabicyclo[3.1.0]hexane?
azane;methane;2-oxabicyclo[3.1.0]hexane has a molecular weight of 117.19 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methane;2-oxabicyclo[3.1.0]hexane is sourced from PubChem (CID 69393686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).