About 2-chloro-[1,2,4]triazolo[1,5-a]pyridine
2-chloro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 69394557) has the molecular formula C6H4ClN3
and a molecular weight of 153.57 g/mol. Its IUPAC name is 2-chloro-[1,2,4]triazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| PubChem CID | 69394557 |
| Molecular Formula | C6H4ClN3 |
| Molecular Weight | 153.57 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | 2-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1nc2ccccn2n1 |
| InChI | InChI=1S/C6H4ClN3/c7-6-8-5-3-1-2-4-10(5)9-6/h1-4H |
| InChIKey | KAMDPUMKFZCZSQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 2-chloro-[1,2,4]triazolo[1,5-a]pyridine (CID 69394557) is 2-chloro-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 2-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 2-chloro-[1,2,4]triazolo[1,5-a]pyridine is Clc1nc2ccccn2n1.
What is the InChIKey of 2-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is KAMDPUMKFZCZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3/c7-6-8-5-3-1-2-4-10(5)9-6/h1-4H.
What are the key properties of 2-chloro-[1,2,4]triazolo[1,5-a]pyridine?
2-chloro-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 153.57 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 69394557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).