C18H32N+ — CID 69394774
1-heptyl-3,4-dipropylpyridin-1-ium (PubChem CID 69394774) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is 1-heptyl-3,4-dipropylpyridin-1-ium.
| Compound Name | 1-heptyl-3,4-dipropylpyridin-1-ium |
|---|---|
| PubChem CID | 69394774 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 1-heptyl-3,4-dipropylpyridin-1-ium |
| SMILES | CCCCCCC[n+]1ccc(CCC)c(CCC)c1 |
| InChI | InChI=1S/C18H32N/c1-4-7-8-9-10-14-19-15-13-17(11-5-2)18(16-19)12-6-3/h13,15-16H,4-12,14H2,1-3H3/q+1 |
| InChIKey | GQMQXJQVWOHXOU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|