C15H26N+ — CID 69395141
1-butyl-3,5-dipropylpyridin-1-ium (PubChem CID 69395141) has the molecular formula C15H26N+ and a molecular weight of 220.38 g/mol. Its IUPAC name is 1-butyl-3,5-dipropylpyridin-1-ium.
| Compound Name | 1-butyl-3,5-dipropylpyridin-1-ium |
|---|---|
| PubChem CID | 69395141 |
| Molecular Formula | C15H26N+ |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | 1-butyl-3,5-dipropylpyridin-1-ium |
| SMILES | CCCC[n+]1cc(CCC)cc(CCC)c1 |
| InChI | InChI=1S/C15H26N/c1-4-7-10-16-12-14(8-5-2)11-15(13-16)9-6-3/h11-13H,4-10H2,1-3H3/q+1 |
| InChIKey | ACEVLXBXQYKOKP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|