C21H42N2 — CID 69395396
1,3-di(nonyl)-2H-imidazole (PubChem CID 69395396) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 1,3-di(nonyl)-2H-imidazole.
| Compound Name | 1,3-di(nonyl)-2H-imidazole |
|---|---|
| PubChem CID | 69395396 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | 1,3-di(nonyl)-2H-imidazole |
| SMILES | CCCCCCCCCN1C=CN(CCCCCCCCC)C1 |
| InChI | InChI=1S/C21H42N2/c1-3-5-7-9-11-13-15-17-22-19-20-23(21-22)18-16-14-12-10-8-6-4-2/h19-20H,3-18,21H2,1-2H3 |
| InChIKey | CHOBIBKPGYJGBJ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|