About (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one
(3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one (PubChem CID 69395607) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one.
Molecular Properties
| Compound Name | (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one |
| PubChem CID | 69395607 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one |
| SMILES | CC(C)=C1OC(=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C8H12O4/c1-4(2)5-6(9)8(3,11)7(10)12-5/h6,9,11H,1-3H3/t6-,8-/m1/s1 |
| InChIKey | GCBUWTZCMCJXSH-HTRCEHHLSA-N |
| XLogP | -0.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one?
The IUPAC name of (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one (CID 69395607) is (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one.
What is the SMILES notation for (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one?
The canonical SMILES for (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one is CC(C)=C1OC(=O)[C@](C)(O)[C@@H]1O.
What is the InChIKey of (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one?
The InChIKey is GCBUWTZCMCJXSH-HTRCEHHLSA-N. The full InChI is InChI=1S/C8H12O4/c1-4(2)5-6(9)8(3,11)7(10)12-5/h6,9,11H,1-3H3/t6-,8-/m1/s1.
What are the key properties of (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one?
(3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one has a molecular weight of 172.18 g/mol, XLogP of -0.05, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dihydroxy-3-methyl-5-propan-2-ylideneoxolan-2-one is sourced from PubChem (CID 69395607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).