About 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one
3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one (PubChem CID 69396012) has the molecular formula C19H23BrClN3O2
and a molecular weight of 440.77 g/mol. Its IUPAC name is 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one |
| PubChem CID | 69396012 |
| Molecular Formula | C19H23BrClN3O2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one |
| SMILES | CCC(CCCl)c1c[nH]c(=O)c(N2CCCc3cc(OC)cc(Br)c32)n1 |
| InChI | InChI=1S/C19H23BrClN3O2/c1-3-12(6-7-21)16-11-22-19(25)18(23-16)24-8-4-5-13-9-14(26-2)10-15(20)17(13)24/h9-12H,3-8H2,1-2H3,(H,22,25) |
| InChIKey | ZRRMLAKWCTWZCM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one?
The IUPAC name of 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one (CID 69396012) is 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one.
What is the SMILES notation for 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one?
The canonical SMILES for 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one is CCC(CCCl)c1c[nH]c(=O)c(N2CCCc3cc(OC)cc(Br)c32)n1.
What is the InChIKey of 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one?
The InChIKey is ZRRMLAKWCTWZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrClN3O2/c1-3-12(6-7-21)16-11-22-19(25)18(23-16)24-8-4-5-13-9-14(26-2)10-15(20)17(13)24/h9-12H,3-8H2,1-2H3,(H,22,25).
What are the key properties of 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one?
3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one has a molecular weight of 440.77 g/mol, XLogP of 4.75, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-bromo-6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-5-(1-chloropentan-3-yl)-1H-pyrazin-2-one is sourced from PubChem (CID 69396012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).