C11H18N+ — CID 69396586
1,4-dipropylpyridin-1-ium (PubChem CID 69396586) has the molecular formula C11H18N+ and a molecular weight of 164.27 g/mol. Its IUPAC name is 1,4-dipropylpyridin-1-ium.
| Compound Name | 1,4-dipropylpyridin-1-ium |
|---|---|
| PubChem CID | 69396586 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | 1,4-dipropylpyridin-1-ium |
| SMILES | CCCc1cc[n+](CCC)cc1 |
| InChI | InChI=1S/C11H18N/c1-3-5-11-6-9-12(8-4-2)10-7-11/h6-7,9-10H,3-5,8H2,1-2H3/q+1 |
| InChIKey | YRFTZCFZCKLYHL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|