C19H28O2 — CID 69396880
(10S,13S,14R)-10,13-dimethyl-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,3-diol (PubChem CID 69396880) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (10S,13S,14R)-10,13-dimethyl-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,3-diol.
| Compound Name | (10S,13S,14R)-10,13-dimethyl-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,3-diol |
|---|---|
| PubChem CID | 69396880 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (10S,13S,14R)-10,13-dimethyl-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,3-diol |
| SMILES | C[C@]12CCC(O)(O)C=C1CCC1=C2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C19H28O2/c1-17-8-3-4-15(17)14-6-5-13-12-19(20,21)11-10-18(13,2)16(14)7-9-17/h12,15,20-21H,3-11H2,1-2H3/t15-,17-,18-/m0/s1 |
| InChIKey | TWZXEVOBZDLLHJ-SZMVWBNQSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|