C26H27F3N4O4 — CID 69397494
methyl 2-methyl-2-[4-[4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoate (PubChem CID 69397494) has the molecular formula C26H27F3N4O4 and a molecular weight of 516.52 g/mol. Its IUPAC name is methyl 2-methyl-2-[4-[4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoate.
| Compound Name | methyl 2-methyl-2-[4-[4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 69397494 |
| Molecular Formula | C26H27F3N4O4 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl 2-methyl-2-[4-[4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoate |
| SMILES | COC(=O)C(C)(C)C1CCC(c2ccc(NC(=O)c3nnc(Nc4ccc(F)c(F)c4F)o3)cc2)CC1 |
| InChI | InChI=1S/C26H27F3N4O4/c1-26(2,24(35)36-3)16-8-4-14(5-9-16)15-6-10-17(11-7-15)30-22(34)23-32-33-25(37-23)31-19-13-12-18(27)20(28)21(19)29/h6-7,10-14,16H,4-5,8-9H2,1-3H3,(H,30,34)(H,31,33) |
| InChIKey | OFLZYWLLNFSUQZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|