C24H44N+ — CID 69397631
3,4-diheptyl-1-pentylpyridin-1-ium (PubChem CID 69397631) has the molecular formula C24H44N+ and a molecular weight of 346.62 g/mol. Its IUPAC name is 3,4-diheptyl-1-pentylpyridin-1-ium.
| Compound Name | 3,4-diheptyl-1-pentylpyridin-1-ium |
|---|---|
| PubChem CID | 69397631 |
| Molecular Formula | C24H44N+ |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.35 |
| IUPAC Name | 3,4-diheptyl-1-pentylpyridin-1-ium |
| SMILES | CCCCCCCc1cc[n+](CCCCC)cc1CCCCCCC |
| InChI | InChI=1S/C24H44N/c1-4-7-10-12-14-17-23-19-21-25(20-16-9-6-3)22-24(23)18-15-13-11-8-5-2/h19,21-22H,4-18,20H2,1-3H3/q+1 |
| InChIKey | KSVVWNNPBRPAMS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|