About 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea (PubChem CID 69397929) has the molecular formula C22H20N4O2
and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea |
| PubChem CID | 69397929 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(N(C(N)=O)c2ccc(-c3cccc4onc(N)c34)cc2)c1 |
| InChI | InChI=1S/C22H20N4O2/c1-13-10-14(2)12-17(11-13)26(22(24)27)16-8-6-15(7-9-16)18-4-3-5-19-20(18)21(23)25-28-19/h3-12H,1-2H3,(H2,23,25)(H2,24,27) |
| InChIKey | MUXGKPFJVYIEGL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea?
The IUPAC name of 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea (CID 69397929) is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea.
What is the SMILES notation for 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea?
The canonical SMILES for 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea is Cc1cc(C)cc(N(C(N)=O)c2ccc(-c3cccc4onc(N)c34)cc2)c1.
What is the InChIKey of 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea?
The InChIKey is MUXGKPFJVYIEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O2/c1-13-10-14(2)12-17(11-13)26(22(24)27)16-8-6-15(7-9-16)18-4-3-5-19-20(18)21(23)25-28-19/h3-12H,1-2H3,(H2,23,25)(H2,24,27).
What are the key properties of 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea?
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea has a molecular weight of 372.43 g/mol, XLogP of 4.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-1-(3,5-dimethylphenyl)urea is sourced from PubChem (CID 69397929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).