About ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine
ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine (PubChem CID 69398254) has the molecular formula C31H24N4O2
and a molecular weight of 484.56 g/mol. Its IUPAC name is ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine |
| PubChem CID | 69398254 |
| Molecular Formula | C31H24N4O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine |
| SMILES | CCOC(=O)c1cc2cccnc2nc1-c1ccccc1.c1ccc(-c2ccc3cccnc3n2)cc1 |
| InChI | InChI=1S/C17H14N2O2.C14H10N2/c1-2-21-17(20)14-11-13-9-6-10-18-16(13)19-15(14)12-7-4-3-5-8-12;1-2-5-11(6-3-1)13-9-8-12-7-4-10-15-14(12)16-13/h3-11H,2H2,1H3;1-10H |
| InChIKey | WMUPUFMCZIFTGP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine?
The IUPAC name of ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine (CID 69398254) is ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine.
What is the SMILES notation for ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine?
The canonical SMILES for ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine is CCOC(=O)c1cc2cccnc2nc1-c1ccccc1.c1ccc(-c2ccc3cccnc3n2)cc1.
What is the InChIKey of ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine?
The InChIKey is WMUPUFMCZIFTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2.C14H10N2/c1-2-21-17(20)14-11-13-9-6-10-18-16(13)19-15(14)12-7-4-3-5-8-12;1-2-5-11(6-3-1)13-9-8-12-7-4-10-15-14(12)16-13/h3-11H,2H2,1H3;1-10H.
What are the key properties of ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine?
ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine has a molecular weight of 484.56 g/mol, XLogP of 6.77, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenyl-1,8-naphthyridine-3-carboxylate;2-phenyl-1,8-naphthyridine is sourced from PubChem (CID 69398254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).