About 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene
3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene (PubChem CID 69398684) has the molecular formula C17H13NO4
and a molecular weight of 295.29 g/mol. Its IUPAC name is 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene.
Molecular Properties
| Compound Name | 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene |
| PubChem CID | 69398684 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene |
| SMILES | CC1(C)C=Cc2c(ccc3oc4c([N+](=O)[O-])cccc4c23)O1 |
| InChI | InChI=1S/C17H13NO4/c1-17(2)9-8-10-13(22-17)6-7-14-15(10)11-4-3-5-12(18(19)20)16(11)21-14/h3-9H,1-2H3 |
| InChIKey | URKCCTMWOSUVOV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene?
The IUPAC name of 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene (CID 69398684) is 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene.
What is the SMILES notation for 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene?
The canonical SMILES for 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene is CC1(C)C=Cc2c(ccc3oc4c([N+](=O)[O-])cccc4c23)O1.
What is the InChIKey of 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene?
The InChIKey is URKCCTMWOSUVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4/c1-17(2)9-8-10-13(22-17)6-7-14-15(10)11-4-3-5-12(18(19)20)16(11)21-14/h3-9H,1-2H3.
What are the key properties of 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene?
3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene has a molecular weight of 295.29 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-8-nitro-[1]benzofuro[3,2-f]chromene is sourced from PubChem (CID 69398684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).