C23H26N6O2 — CID 69398883
propyl N-methyl-N-[[4-(7-phenyl-3,4-dihydro-2H-1,6-naphthyridin-1-yl)pyrimidin-2-yl]amino]carbamate (PubChem CID 69398883) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is propyl N-methyl-N-[[4-(7-phenyl-3,4-dihydro-2H-1,6-naphthyridin-1-yl)pyrimidin-2-yl]amino]carbamate.
| Compound Name | propyl N-methyl-N-[[4-(7-phenyl-3,4-dihydro-2H-1,6-naphthyridin-1-yl)pyrimidin-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 69398883 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | propyl N-methyl-N-[[4-(7-phenyl-3,4-dihydro-2H-1,6-naphthyridin-1-yl)pyrimidin-2-yl]amino]carbamate |
| SMILES | CCCOC(=O)N(C)Nc1nccc(N2CCCc3cnc(-c4ccccc4)cc32)n1 |
| InChI | InChI=1S/C23H26N6O2/c1-3-14-31-23(30)28(2)27-22-24-12-11-21(26-22)29-13-7-10-18-16-25-19(15-20(18)29)17-8-5-4-6-9-17/h4-6,8-9,11-12,15-16H,3,7,10,13-14H2,1-2H3,(H,24,26,27) |
| InChIKey | BKAPVXCOKNUSCP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|