About [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid
[1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid (PubChem CID 69398927) has the molecular formula C17H16FN3O3
and a molecular weight of 329.33 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid.
Molecular Properties
| Compound Name | [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid |
| PubChem CID | 69398927 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1Cc2cccnc2N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H16FN3O3/c18-14-5-3-11(4-6-14)10-21-15-12(2-1-7-19-15)8-13(16(21)22)9-20-17(23)24/h1-7,13,20H,8-10H2,(H,23,24) |
| InChIKey | CBDMXZZGIUYYOD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid?
The IUPAC name of [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid (CID 69398927) is [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid.
What is the SMILES notation for [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid?
The canonical SMILES for [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid is O=C(O)NCC1Cc2cccnc2N(Cc2ccc(F)cc2)C1=O.
What is the InChIKey of [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid?
The InChIKey is CBDMXZZGIUYYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O3/c18-14-5-3-11(4-6-14)10-21-15-12(2-1-7-19-15)8-13(16(21)22)9-20-17(23)24/h1-7,13,20H,8-10H2,(H,23,24).
What are the key properties of [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid?
[1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid has a molecular weight of 329.33 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-fluorophenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridin-3-yl]methylcarbamic acid is sourced from PubChem (CID 69398927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).