About 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid
3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid (PubChem CID 69398929) has the molecular formula C17H16Br2ClNO6S
and a molecular weight of 557.64 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid |
| PubChem CID | 69398929 |
| Molecular Formula | C17H16Br2ClNO6S |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 554.88 |
| IUPAC Name | 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid |
| SMILES | CS(=O)(=O)Nc1cccc(COc2c(Br)cc(CC(O)C(=O)O)cc2Br)c1Cl |
| InChI | InChI=1S/C17H16Br2ClNO6S/c1-28(25,26)21-13-4-2-3-10(15(13)20)8-27-16-11(18)5-9(6-12(16)19)7-14(22)17(23)24/h2-6,14,21-22H,7-8H2,1H3,(H,23,24) |
| InChIKey | LGIBOSSFBDXJOV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid?
The IUPAC name of 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid (CID 69398929) is 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid.
What is the SMILES notation for 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid?
The canonical SMILES for 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid is CS(=O)(=O)Nc1cccc(COc2c(Br)cc(CC(O)C(=O)O)cc2Br)c1Cl.
What is the InChIKey of 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid?
The InChIKey is LGIBOSSFBDXJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Br2ClNO6S/c1-28(25,26)21-13-4-2-3-10(15(13)20)8-27-16-11(18)5-9(6-12(16)19)7-14(22)17(23)24/h2-6,14,21-22H,7-8H2,1H3,(H,23,24).
What are the key properties of 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid?
3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid has a molecular weight of 557.64 g/mol, XLogP of 3.80, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dibromo-4-[[2-chloro-3-(methanesulfonamido)phenyl]methoxy]phenyl]-2-hydroxypropanoic acid is sourced from PubChem (CID 69398929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).