C19H16FN2O+ — CID 6939947
(2R)-2-(4-fluorophenyl)-1-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 6939947) has the molecular formula C19H16FN2O+ and a molecular weight of 307.35 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-1-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
| Compound Name | (2R)-2-(4-fluorophenyl)-1-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
|---|---|
| PubChem CID | 6939947 |
| Molecular Formula | C19H16FN2O+ |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-1-phenyl-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | O[C@]1(c2ccc(F)cc2)C[n+]2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C19H16FN2O/c20-16-11-9-15(10-12-16)19(23)14-21-13-5-4-8-18(21)22(19)17-6-2-1-3-7-17/h1-13,23H,14H2/q+1/t19-/m0/s1 |
| InChIKey | YNIASIPVRBNPGJ-IBGZPJMESA-N |
| XLogP | 3.11 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|