C26H28N4O3 — CID 69399472
(1R)-1'-(4-amino-2-pyridinyl)-N-(2-phenoxyethyl)spiro[1H-2-benzofuran-3,4'-piperidine]-1-carboxamide (PubChem CID 69399472) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (1R)-1'-(4-amino-2-pyridinyl)-N-(2-phenoxyethyl)spiro[1H-2-benzofuran-3,4'-piperidine]-1-carboxamide.
| Compound Name | (1R)-1'-(4-amino-2-pyridinyl)-N-(2-phenoxyethyl)spiro[1H-2-benzofuran-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 69399472 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (1R)-1'-(4-amino-2-pyridinyl)-N-(2-phenoxyethyl)spiro[1H-2-benzofuran-3,4'-piperidine]-1-carboxamide |
| SMILES | Nc1ccnc(N2CCC3(CC2)O[C@@H](C(=O)NCCOc2ccccc2)c2ccccc23)c1 |
| InChI | InChI=1S/C26H28N4O3/c27-19-10-13-28-23(18-19)30-15-11-26(12-16-30)22-9-5-4-8-21(22)24(33-26)25(31)29-14-17-32-20-6-2-1-3-7-20/h1-10,13,18,24H,11-12,14-17H2,(H2,27,28)(H,29,31)/t24-/m1/s1 |
| InChIKey | QNWMKAJZRKFFPP-XMMPIXPASA-N |
| XLogP | 3.43 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|