C24H23ClN4O2 — CID 69399658
N-benzyl-6-[3-(2-chlorobenzoyl)-1,3-diazinan-1-yl]pyridine-3-carboxamide (PubChem CID 69399658) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is N-benzyl-6-[3-(2-chlorobenzoyl)-1,3-diazinan-1-yl]pyridine-3-carboxamide.
| Compound Name | N-benzyl-6-[3-(2-chlorobenzoyl)-1,3-diazinan-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69399658 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-benzyl-6-[3-(2-chlorobenzoyl)-1,3-diazinan-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(N2CCCN(C(=O)c3ccccc3Cl)C2)nc1 |
| InChI | InChI=1S/C24H23ClN4O2/c25-21-10-5-4-9-20(21)24(31)29-14-6-13-28(17-29)22-12-11-19(16-26-22)23(30)27-15-18-7-2-1-3-8-18/h1-5,7-12,16H,6,13-15,17H2,(H,27,30) |
| InChIKey | ANOYABWQOIUHEU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |