About N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide
N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide (PubChem CID 69400082) has the molecular formula C18H17FN4O4
and a molecular weight of 372.36 g/mol. Its IUPAC name is N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide |
| PubChem CID | 69400082 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc2c(n1)CCN(C(=O)c1c(F)cccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C18H17FN4O4/c1-2-20-17(24)14-7-6-11-10-22(9-8-13(11)21-14)18(25)16-12(19)4-3-5-15(16)23(26)27/h3-7H,2,8-10H2,1H3,(H,20,24) |
| InChIKey | FSRUTAMPXWZUBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide?
The IUPAC name of N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide (CID 69400082) is N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide.
What is the SMILES notation for N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide?
The canonical SMILES for N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide is CCNC(=O)c1ccc2c(n1)CCN(C(=O)c1c(F)cccc1[N+](=O)[O-])C2.
What is the InChIKey of N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide?
The InChIKey is FSRUTAMPXWZUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4O4/c1-2-20-17(24)14-7-6-11-10-22(9-8-13(11)21-14)18(25)16-12(19)4-3-5-15(16)23(26)27/h3-7H,2,8-10H2,1H3,(H,20,24).
What are the key properties of N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide?
N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide has a molecular weight of 372.36 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-(2-fluoro-6-nitrobenzoyl)-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide is sourced from PubChem (CID 69400082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).