C32H26FN3O3 — CID 69400211
3-[1-(1-benzylpiperidin-3-yl)indol-3-yl]-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione (PubChem CID 69400211) has the molecular formula C32H26FN3O3 and a molecular weight of 519.58 g/mol. Its IUPAC name is 3-[1-(1-benzylpiperidin-3-yl)indol-3-yl]-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(1-benzylpiperidin-3-yl)indol-3-yl]-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69400211 |
| Molecular Formula | C32H26FN3O3 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-[1-(1-benzylpiperidin-3-yl)indol-3-yl]-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c(F)ccc3ccoc23)=C1c1cn(C2CCCN(Cc3ccccc3)C2)c2ccccc12 |
| InChI | InChI=1S/C32H26FN3O3/c33-25-13-12-21-14-16-39-30(21)28(25)29-27(31(37)34-32(29)38)24-19-36(26-11-5-4-10-23(24)26)22-9-6-15-35(18-22)17-20-7-2-1-3-8-20/h1-5,7-8,10-14,16,19,22H,6,9,15,17-18H2,(H,34,37,38) |
| InChIKey | PIXSQMCKAYXFIU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|