C26H20ClF4N3O3 — CID 69400633
3-(6-fluoro-1-benzofuran-7-yl)-4-[1-piperidin-4-yl-5-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione;hydrochloride (PubChem CID 69400633) has the molecular formula C26H20ClF4N3O3 and a molecular weight of 533.91 g/mol. Its IUPAC name is 3-(6-fluoro-1-benzofuran-7-yl)-4-[1-piperidin-4-yl-5-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione;hydrochloride.
| Compound Name | 3-(6-fluoro-1-benzofuran-7-yl)-4-[1-piperidin-4-yl-5-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 69400633 |
| Molecular Formula | C26H20ClF4N3O3 |
| Molecular Weight | 533.91 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 3-(6-fluoro-1-benzofuran-7-yl)-4-[1-piperidin-4-yl-5-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)C(c2c(F)ccc3ccoc23)=C1c1cn(C2CCNCC2)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C26H19F4N3O3.ClH/c27-18-3-1-13-7-10-36-23(13)21(18)22-20(24(34)32-25(22)35)17-12-33(15-5-8-31-9-6-15)19-4-2-14(11-16(17)19)26(28,29)30;/h1-4,7,10-12,15,31H,5-6,8-9H2,(H,32,34,35);1H |
| InChIKey | AOPIOBVIOOBGLQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|