C25H43NO11 — CID 69401515
2-[3-[3,3,3-tris[2-(2-methoxyethoxy)ethoxy]propyl]-2-pyridinyl]acetic acid (PubChem CID 69401515) has the molecular formula C25H43NO11 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[3-[3,3,3-tris[2-(2-methoxyethoxy)ethoxy]propyl]-2-pyridinyl]acetic acid.
| Compound Name | 2-[3-[3,3,3-tris[2-(2-methoxyethoxy)ethoxy]propyl]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 69401515 |
| Molecular Formula | C25H43NO11 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-[3-[3,3,3-tris[2-(2-methoxyethoxy)ethoxy]propyl]-2-pyridinyl]acetic acid |
| SMILES | COCCOCCOC(CCc1cccnc1CC(=O)O)(OCCOCCOC)OCCOCCOC |
| InChI | InChI=1S/C25H43NO11/c1-29-9-12-32-15-18-35-25(36-19-16-33-13-10-30-2,37-20-17-34-14-11-31-3)7-6-22-5-4-8-26-23(22)21-24(27)28/h4-5,8H,6-7,9-21H2,1-3H3,(H,27,28) |
| InChIKey | OTZMIJRULRKLLS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|