C25H23N5O3 — CID 69401646
2-ethyl-9-methyl-13-[2-[(2-oxo-1H-quinolin-4-yl)oxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 69401646) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-ethyl-9-methyl-13-[2-[(2-oxo-1H-quinolin-4-yl)oxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-9-methyl-13-[2-[(2-oxo-1H-quinolin-4-yl)oxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 69401646 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-ethyl-9-methyl-13-[2-[(2-oxo-1H-quinolin-4-yl)oxy]ethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(CCOc3cc(=O)[nH]c4ccccc34)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C25H23N5O3/c1-3-30-23-18(25(32)29(2)20-9-6-11-26-24(20)30)13-16(15-27-23)10-12-33-21-14-22(31)28-19-8-5-4-7-17(19)21/h4-9,11,13-15H,3,10,12H2,1-2H3,(H,28,31) |
| InChIKey | WCFTUUJKTGUEQR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |