C7H7N — CID 69401659
bicyclo[4.1.0]hepta-1,3,5-trien-7-amine (PubChem CID 69401659) has the molecular formula C7H7N and a molecular weight of 105.14 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-amine.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
|---|---|
| PubChem CID | 69401659 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
| SMILES | NC1c2ccccc21 |
| InChI | InChI=1S/C7H7N/c8-7-5-3-1-2-4-6(5)7/h1-4,7H,8H2 |
| InChIKey | QDMPNMSTDGPCSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |