About bicyclo[4.1.0]hepta-1,3,5-trien-7-amine
bicyclo[4.1.0]hepta-1,3,5-trien-7-amine (PubChem CID 69401659) has the molecular formula C7H7N
and a molecular weight of 105.14 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-amine.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
| PubChem CID | 69401659 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
| SMILES | NC1c2ccccc21 |
| InChI | InChI=1S/C7H7N/c8-7-5-3-1-2-4-6(5)7/h1-4,7H,8H2 |
| InChIKey | QDMPNMSTDGPCSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.1.0]hepta-1,3,5-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-amine (CID 69401659) is bicyclo[4.1.0]hepta-1,3,5-trien-7-amine.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-trien-7-amine is NC1c2ccccc21.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The InChIKey is QDMPNMSTDGPCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N/c8-7-5-3-1-2-4-6(5)7/h1-4,7H,8H2.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
bicyclo[4.1.0]hepta-1,3,5-trien-7-amine has a molecular weight of 105.14 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-trien-7-amine is sourced from PubChem (CID 69401659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).