C19H19F3N4O — CID 69402755
1-N'-[7-(4-methoxyphenyl)-2-(trifluoromethyl)-1,6-naphthyridin-5-yl]propane-1,1-diamine (PubChem CID 69402755) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 1-N'-[7-(4-methoxyphenyl)-2-(trifluoromethyl)-1,6-naphthyridin-5-yl]propane-1,1-diamine.
| Compound Name | 1-N'-[7-(4-methoxyphenyl)-2-(trifluoromethyl)-1,6-naphthyridin-5-yl]propane-1,1-diamine |
|---|---|
| PubChem CID | 69402755 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-N'-[7-(4-methoxyphenyl)-2-(trifluoromethyl)-1,6-naphthyridin-5-yl]propane-1,1-diamine |
| SMILES | CCC(N)Nc1nc(-c2ccc(OC)cc2)cc2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H19F3N4O/c1-3-17(23)26-18-13-8-9-16(19(20,21)22)24-15(13)10-14(25-18)11-4-6-12(27-2)7-5-11/h4-10,17H,3,23H2,1-2H3,(H,25,26) |
| InChIKey | FQEKDMBAHYLWGS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|