About 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate
2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 69402955) has the molecular formula C24H21FO2
and a molecular weight of 360.43 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate |
| PubChem CID | 69402955 |
| Molecular Formula | C24H21FO2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC(C(=O)Oc1ccc2c(c1)CCC2)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H21FO2/c1-16(24(26)27-21-12-10-17-8-5-9-20(17)14-21)19-11-13-22(23(25)15-19)18-6-3-2-4-7-18/h2-4,6-7,10-16H,5,8-9H2,1H3 |
| InChIKey | APSGHFWIULCEOY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate?
The IUPAC name of 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate (CID 69402955) is 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate.
What is the SMILES notation for 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate?
The canonical SMILES for 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate is CC(C(=O)Oc1ccc2c(c1)CCC2)c1ccc(-c2ccccc2)c(F)c1.
What is the InChIKey of 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate?
The InChIKey is APSGHFWIULCEOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FO2/c1-16(24(26)27-21-12-10-17-8-5-9-20(17)14-21)19-11-13-22(23(25)15-19)18-6-3-2-4-7-18/h2-4,6-7,10-16H,5,8-9H2,1H3.
What are the key properties of 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate?
2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate has a molecular weight of 360.43 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-5-yl 2-(3-fluoro-4-phenylphenyl)propanoate is sourced from PubChem (CID 69402955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).