C9H15NO2 — CID 69403266
(1S,2R)-2-(ethylamino)cyclohex-3-ene-1-carboxylic acid (PubChem CID 69403266) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (1S,2R)-2-(ethylamino)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,2R)-2-(ethylamino)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 69403266 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (1S,2R)-2-(ethylamino)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCN[C@@H]1C=CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H15NO2/c1-2-10-8-6-4-3-5-7(8)9(11)12/h4,6-8,10H,2-3,5H2,1H3,(H,11,12)/t7-,8+/m0/s1 |
| InChIKey | DPTODIKIHSMAGU-JGVFFNPUSA-N |
| XLogP | 1.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|