C28H28N4O3 — CID 69403828
3-benzyl-5-cyclohexyl-1-[(3-nitrophenyl)methyl]-1,3,4-benzotriazepin-2-one (PubChem CID 69403828) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-benzyl-5-cyclohexyl-1-[(3-nitrophenyl)methyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 3-benzyl-5-cyclohexyl-1-[(3-nitrophenyl)methyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69403828 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-benzyl-5-cyclohexyl-1-[(3-nitrophenyl)methyl]-1,3,4-benzotriazepin-2-one |
| SMILES | O=C1N(Cc2ccccc2)N=C(C2CCCCC2)c2ccccc2N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28N4O3/c33-28-30(19-22-12-9-15-24(18-22)32(34)35)26-17-8-7-16-25(26)27(23-13-5-2-6-14-23)29-31(28)20-21-10-3-1-4-11-21/h1,3-4,7-12,15-18,23H,2,5-6,13-14,19-20H2 |
| InChIKey | QIZMDVDYEQCLQM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|