C12H16INO7 — CID 69403829
[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-iodo-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 69403829) has the molecular formula C12H16INO7 and a molecular weight of 413.16 g/mol. Its IUPAC name is [1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-iodo-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-iodo-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69403829 |
| Molecular Formula | C12H16INO7 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | [1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-iodo-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)C(I)(NC(=O)O)C(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C12H16INO7/c1-5(2)12(13,14-10(18)19)7(15)6-8(16)20-11(3,4)21-9(6)17/h5-6,14H,1-4H3,(H,18,19) |
| InChIKey | JZBYJRGQNKQXDH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|