About 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide
4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide (PubChem CID 69404218) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide |
| PubChem CID | 69404218 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide |
| SMILES | C=Cc1ccc(C(N)=O)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-4-8-5-6-9(11(13)15)10(7-8)12(16)14(2)3/h4-7H,1H2,2-3H3,(H2,13,15) |
| InChIKey | QZOGBYNLEIQEMR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide?
The IUPAC name of 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide (CID 69404218) is 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide.
What is the SMILES notation for 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide?
The canonical SMILES for 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide is C=Cc1ccc(C(N)=O)c(C(=O)N(C)C)c1.
What is the InChIKey of 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide?
The InChIKey is QZOGBYNLEIQEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-4-8-5-6-9(11(13)15)10(7-8)12(16)14(2)3/h4-7H,1H2,2-3H3,(H2,13,15).
What are the key properties of 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide?
4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide has a molecular weight of 218.26 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2-N,2-N-dimethylbenzene-1,2-dicarboxamide is sourced from PubChem (CID 69404218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).