C6H10N10O2 — CID 69404310
6-amino-1H-1,3,5-triazine-2,4-dione;1,3,5-triazine-2,4,6-triamine (PubChem CID 69404310) has the molecular formula C6H10N10O2 and a molecular weight of 254.21 g/mol. Its IUPAC name is 6-amino-1H-1,3,5-triazine-2,4-dione;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-amino-1H-1,3,5-triazine-2,4-dione;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69404310 |
| Molecular Formula | C6H10N10O2 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 6-amino-1H-1,3,5-triazine-2,4-dione;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(=O)[nH]c(=O)[nH]1.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C3H6N6.C3H4N4O2/c4-1-7-2(5)9-3(6)8-1;4-1-5-2(8)7-3(9)6-1/h(H6,4,5,6,7,8,9);(H4,4,5,6,7,8,9) |
| InChIKey | LARDZKSUZQELMS-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 221.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |