About 1H-indazole;1,3-oxazolidin-2-one
1H-indazole;1,3-oxazolidin-2-one (PubChem CID 69404481) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 1H-indazole;1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 1H-indazole;1,3-oxazolidin-2-one |
| PubChem CID | 69404481 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1H-indazole;1,3-oxazolidin-2-one |
| SMILES | O=C1NCCO1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.C3H5NO2/c1-2-4-7-6(3-1)5-8-9-7;5-3-4-1-2-6-3/h1-5H,(H,8,9);1-2H2,(H,4,5) |
| InChIKey | UGEPQOLABZQHNU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indazole;1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;1,3-oxazolidin-2-one?
The IUPAC name of 1H-indazole;1,3-oxazolidin-2-one (CID 69404481) is 1H-indazole;1,3-oxazolidin-2-one.
What is the SMILES notation for 1H-indazole;1,3-oxazolidin-2-one?
The canonical SMILES for 1H-indazole;1,3-oxazolidin-2-one is O=C1NCCO1.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;1,3-oxazolidin-2-one?
The InChIKey is UGEPQOLABZQHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C3H5NO2/c1-2-4-7-6(3-1)5-8-9-7;5-3-4-1-2-6-3/h1-5H,(H,8,9);1-2H2,(H,4,5).
What are the key properties of 1H-indazole;1,3-oxazolidin-2-one?
1H-indazole;1,3-oxazolidin-2-one has a molecular weight of 205.22 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;1,3-oxazolidin-2-one is sourced from PubChem (CID 69404481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).