C9H20N4O4 — CID 69404702
2,3-diaminopropanoic acid;2-piperazin-1-ylacetic acid (PubChem CID 69404702) has the molecular formula C9H20N4O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2,3-diaminopropanoic acid;2-piperazin-1-ylacetic acid.
| Compound Name | 2,3-diaminopropanoic acid;2-piperazin-1-ylacetic acid |
|---|---|
| PubChem CID | 69404702 |
| Molecular Formula | C9H20N4O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2,3-diaminopropanoic acid;2-piperazin-1-ylacetic acid |
| SMILES | NCC(N)C(=O)O.O=C(O)CN1CCNCC1 |
| InChI | InChI=1S/C6H12N2O2.C3H8N2O2/c9-6(10)5-8-3-1-7-2-4-8;4-1-2(5)3(6)7/h7H,1-5H2,(H,9,10);2H,1,4-5H2,(H,6,7) |
| InChIKey | UZNDAYQEOVCASP-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |