C22H22FNO7 — CID 69404789
[(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 69404789) has the molecular formula C22H22FNO7 and a molecular weight of 431.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 69404789 |
| Molecular Formula | C22H22FNO7 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](F)[C@@H](COC(=O)c2ccccc2)O[C@@H]1O |
| InChI | InChI=1S/C22H22FNO7/c1-13(25)24-18-19(31-21(27)15-10-6-3-7-11-15)17(23)16(30-22(18)28)12-29-20(26)14-8-4-2-5-9-14/h2-11,16-19,22,28H,12H2,1H3,(H,24,25)/t16-,17-,18-,19+,22+/m1/s1 |
| InChIKey | MGFAVUIXGLESSX-DIGZUXTDSA-N |
| XLogP | 1.63 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |