C29H31N5O3 — CID 69404834
3-benzyl-5-cyclohexyl-7-(dimethylamino)-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one (PubChem CID 69404834) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-benzyl-5-cyclohexyl-7-(dimethylamino)-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 3-benzyl-5-cyclohexyl-7-(dimethylamino)-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 69404834 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 3-benzyl-5-cyclohexyl-7-(dimethylamino)-1-(4-nitrophenyl)-1,3,4-benzotriazepin-2-one |
| SMILES | CN(C)c1ccc2c(c1)C(C1CCCCC1)=NN(Cc1ccccc1)C(=O)N2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H31N5O3/c1-31(2)25-17-18-27-26(19-25)28(22-11-7-4-8-12-22)30-32(20-21-9-5-3-6-10-21)29(35)33(27)23-13-15-24(16-14-23)34(36)37/h3,5-6,9-10,13-19,22H,4,7-8,11-12,20H2,1-2H3 |
| InChIKey | LXHICXVPLXUZAF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|