C27H33N3O — CID 69405463
N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-(4-ethenylphenyl)-1H-indol-3-yl]acetamide (PubChem CID 69405463) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-(4-ethenylphenyl)-1H-indol-3-yl]acetamide.
| Compound Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-(4-ethenylphenyl)-1H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 69405463 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-(4-ethenylphenyl)-1H-indol-3-yl]acetamide |
| SMILES | C=Cc1ccc(-c2ccc3c(CC(=O)NCCN(C)C4CCCCC4)c[nH]c3c2)cc1 |
| InChI | InChI=1S/C27H33N3O/c1-3-20-9-11-21(12-10-20)22-13-14-25-23(19-29-26(25)17-22)18-27(31)28-15-16-30(2)24-7-5-4-6-8-24/h3,9-14,17,19,24,29H,1,4-8,15-16,18H2,2H3,(H,28,31) |
| InChIKey | OTFHWYGXXXONBX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |