C8H14N2O2 — CID 69405467
2-amino-4-(2,5-dihydropyrrol-1-yl)butanoic acid (PubChem CID 69405467) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-amino-4-(2,5-dihydropyrrol-1-yl)butanoic acid.
| Compound Name | 2-amino-4-(2,5-dihydropyrrol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 69405467 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-amino-4-(2,5-dihydropyrrol-1-yl)butanoic acid |
| SMILES | NC(CCN1CC=CC1)C(=O)O |
| InChI | InChI=1S/C8H14N2O2/c9-7(8(11)12)3-6-10-4-1-2-5-10/h1-2,7H,3-6,9H2,(H,11,12) |
| InChIKey | CFESAJKRMAVFAY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|