C23H18N4O3S2 — CID 69405482
3-[[2-[(4-methoxyphenyl)methyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione (PubChem CID 69405482) has the molecular formula C23H18N4O3S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 3-[[2-[(4-methoxyphenyl)methyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione.
| Compound Name | 3-[[2-[(4-methoxyphenyl)methyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 69405482 |
| Molecular Formula | C23H18N4O3S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 3-[[2-[(4-methoxyphenyl)methyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
| SMILES | COc1ccc(Cc2nc(NC3=C(C)C(=O)NC3=O)c3c(-c4cccs4)csc3n2)cc1 |
| InChI | InChI=1S/C23H18N4O3S2/c1-12-19(22(29)27-21(12)28)26-20-18-15(16-4-3-9-31-16)11-32-23(18)25-17(24-20)10-13-5-7-14(30-2)8-6-13/h3-9,11H,10H2,1-2H3,(H2,24,25,26,27,28,29) |
| InChIKey | LYISHQOEMGBMSE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|