About (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one
(6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one (PubChem CID 69405528) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one.
Molecular Properties
| Compound Name | (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one |
| PubChem CID | 69405528 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one |
| SMILES | CC1(C)OC2=COC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C7H8O4/c1-7(2)10-4-3-9-6(8)5(4)11-7/h3,5H,1-2H3/t5-/m1/s1 |
| InChIKey | RSZNGCBLIBFEEO-RXMQYKEDSA-N |
| XLogP | 0.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one?
The IUPAC name of (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one (CID 69405528) is (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one.
What is the SMILES notation for (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one?
The canonical SMILES for (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one is CC1(C)OC2=COC(=O)[C@@H]2O1.
What is the InChIKey of (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one?
The InChIKey is RSZNGCBLIBFEEO-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H8O4/c1-7(2)10-4-3-9-6(8)5(4)11-7/h3,5H,1-2H3/t5-/m1/s1.
What are the key properties of (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one?
(6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one has a molecular weight of 156.14 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6aR)-2,2-dimethyl-6aH-furo[3,4-d][1,3]dioxol-6-one is sourced from PubChem (CID 69405528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).