C21H25NO3 — CID 69405899
6-[methyl(2-phenylethyl)amino]-6-oxo-5-phenylhexanoic acid (PubChem CID 69405899) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 6-[methyl(2-phenylethyl)amino]-6-oxo-5-phenylhexanoic acid.
| Compound Name | 6-[methyl(2-phenylethyl)amino]-6-oxo-5-phenylhexanoic acid |
|---|---|
| PubChem CID | 69405899 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 6-[methyl(2-phenylethyl)amino]-6-oxo-5-phenylhexanoic acid |
| SMILES | CN(CCc1ccccc1)C(=O)C(CCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-22(16-15-17-9-4-2-5-10-17)21(25)19(13-8-14-20(23)24)18-11-6-3-7-12-18/h2-7,9-12,19H,8,13-16H2,1H3,(H,23,24) |
| InChIKey | WCBSFRBVZRZMJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |