C12H15NO8 — CID 69406714
2,7a-dihydroxy-4,5,6,7-tetrahydro-3aH-isoindole-1,3-dione;(Z)-but-2-enedioic acid (PubChem CID 69406714) has the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. Its IUPAC name is 2,7a-dihydroxy-4,5,6,7-tetrahydro-3aH-isoindole-1,3-dione;(Z)-but-2-enedioic acid.
| Compound Name | 2,7a-dihydroxy-4,5,6,7-tetrahydro-3aH-isoindole-1,3-dione;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 69406714 |
| Molecular Formula | C12H15NO8 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2,7a-dihydroxy-4,5,6,7-tetrahydro-3aH-isoindole-1,3-dione;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=C1C2CCCCC2(O)C(=O)N1O |
| InChI | InChI=1S/C8H11NO4.C4H4O4/c10-6-5-3-1-2-4-8(5,12)7(11)9(6)13;5-3(6)1-2-4(7)8/h5,12-13H,1-4H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CJKHECFPULYDGZ-BTJKTKAUSA-N |
| XLogP | -0.62 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|