C13H28N4O — CID 69406753
5-(1-methoxyprop-2-enyl)-1,4,7,10-tetrazacyclotridecane (PubChem CID 69406753) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 5-(1-methoxyprop-2-enyl)-1,4,7,10-tetrazacyclotridecane.
| Compound Name | 5-(1-methoxyprop-2-enyl)-1,4,7,10-tetrazacyclotridecane |
|---|---|
| PubChem CID | 69406753 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 5-(1-methoxyprop-2-enyl)-1,4,7,10-tetrazacyclotridecane |
| SMILES | C=CC(OC)C1CNCCNCCCNCCN1 |
| InChI | InChI=1S/C13H28N4O/c1-3-13(18-2)12-11-16-8-7-14-5-4-6-15-9-10-17-12/h3,12-17H,1,4-11H2,2H3 |
| InChIKey | MPUHIEFETGTRAZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|