C19H22N2O3S2 — CID 69407357
1-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]sulfanyl-N,N-dimethylethanamine (PubChem CID 69407357) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]sulfanyl-N,N-dimethylethanamine.
| Compound Name | 1-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]sulfanyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 69407357 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]sulfanyl-N,N-dimethylethanamine |
| SMILES | COc1ccc2c(c1)c(SC(C)N(C)C)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-14(20(2)3)25-19-13-21(18-11-10-15(24-4)12-17(18)19)26(22,23)16-8-6-5-7-9-16/h5-14H,1-4H3 |
| InChIKey | YBPDBNGIIMYDGB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|